C16H20N2O — CID 112558169
1-(4-aminophenyl)-N,N-bis(prop-2-enyl)cyclopropane-1-carboxamide (PubChem CID 112558169) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-(4-aminophenyl)-N,N-bis(prop-2-enyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(4-aminophenyl)-N,N-bis(prop-2-enyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 112558169 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1-(4-aminophenyl)-N,N-bis(prop-2-enyl)cyclopropane-1-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1(c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C16H20N2O/c1-3-11-18(12-4-2)15(19)16(9-10-16)13-5-7-14(17)8-6-13/h3-8H,1-2,9-12,17H2 |
| InChIKey | FOPXDXLDWVYEGM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|