C16H18N4O — CID 115913473
1-(4-aminophenyl)-N,N-bis(2-cyanoethyl)cyclopropane-1-carboxamide (PubChem CID 115913473) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-(4-aminophenyl)-N,N-bis(2-cyanoethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(4-aminophenyl)-N,N-bis(2-cyanoethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 115913473 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-(4-aminophenyl)-N,N-bis(2-cyanoethyl)cyclopropane-1-carboxamide |
| SMILES | N#CCCN(CCC#N)C(=O)C1(c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C16H18N4O/c17-9-1-11-20(12-2-10-18)15(21)16(7-8-16)13-3-5-14(19)6-4-13/h3-6H,1-2,7-8,11-12,19H2 |
| InChIKey | MMQWJLNRHYTVON-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 93.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|