C10H16N2O — CID 65464830
1-amino-N,N-bis(prop-2-enyl)cyclopropane-1-carboxamide (PubChem CID 65464830) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-amino-N,N-bis(prop-2-enyl)cyclopropane-1-carboxamide.
| Compound Name | 1-amino-N,N-bis(prop-2-enyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 65464830 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-amino-N,N-bis(prop-2-enyl)cyclopropane-1-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1(N)CC1 |
| InChI | InChI=1S/C10H16N2O/c1-3-7-12(8-4-2)9(13)10(11)5-6-10/h3-4H,1-2,5-8,11H2 |
| InChIKey | WJALDTXXDLBEGJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|