N,N-bis(prop-2-enyl)carbamoyl fluoride

C7H10FNO — CID 21354913

IUPACN,N-bis(prop-2-enyl)carbamoyl fluoride
SMILESC=CCN(CC=C)C(=O)F
InChIInChI=1S/C7H10FNO/c1-3-5-9(6-4-2)7(8)10/h3-4H,1-2,5-6H2
InChIKeyNIVDQFLYKZRYIO-UHFFFAOYSA-N
MW143.16 g/mol
LogP1.75
Rot. Bonds4

About N,N-bis(prop-2-enyl)carbamoyl fluoride

N,N-bis(prop-2-enyl)carbamoyl fluoride (PubChem CID 21354913) has the molecular formula C7H10FNO and a molecular weight of 143.16 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)carbamoyl fluoride.

Molecular Properties

Compound NameN,N-bis(prop-2-enyl)carbamoyl fluoride
PubChem CID21354913
Molecular FormulaC7H10FNO
Molecular Weight143.16 g/mol
Exact Mass143.07
IUPAC NameN,N-bis(prop-2-enyl)carbamoyl fluoride
SMILESC=CCN(CC=C)C(=O)F
InChIInChI=1S/C7H10FNO/c1-3-5-9(6-4-2)7(8)10/h3-4H,1-2,5-6H2
InChIKeyNIVDQFLYKZRYIO-UHFFFAOYSA-N
XLogP1.75
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.16
LogP ≤ 51.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N,N-bis(prop-2-enyl)carbamoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-bis(prop-2-enyl)carbamoyl fluoride?
The IUPAC name of N,N-bis(prop-2-enyl)carbamoyl fluoride (CID 21354913) is N,N-bis(prop-2-enyl)carbamoyl fluoride.
What is the SMILES notation for N,N-bis(prop-2-enyl)carbamoyl fluoride?
The canonical SMILES for N,N-bis(prop-2-enyl)carbamoyl fluoride is C=CCN(CC=C)C(=O)F.
What is the InChIKey of N,N-bis(prop-2-enyl)carbamoyl fluoride?
The InChIKey is NIVDQFLYKZRYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FNO/c1-3-5-9(6-4-2)7(8)10/h3-4H,1-2,5-6H2.
What are the key properties of N,N-bis(prop-2-enyl)carbamoyl fluoride?
N,N-bis(prop-2-enyl)carbamoyl fluoride has a molecular weight of 143.16 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(prop-2-enyl)carbamoyl fluoride is sourced from PubChem (CID 21354913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).