C7H10FNO — CID 21354913
N,N-bis(prop-2-enyl)carbamoyl fluoride (PubChem CID 21354913) has the molecular formula C7H10FNO and a molecular weight of 143.16 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)carbamoyl fluoride.
| Compound Name | N,N-bis(prop-2-enyl)carbamoyl fluoride |
|---|---|
| PubChem CID | 21354913 |
| Molecular Formula | C7H10FNO |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | N,N-bis(prop-2-enyl)carbamoyl fluoride |
| SMILES | C=CCN(CC=C)C(=O)F |
| InChI | InChI=1S/C7H10FNO/c1-3-5-9(6-4-2)7(8)10/h3-4H,1-2,5-6H2 |
| InChIKey | NIVDQFLYKZRYIO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|