C8H12FNO — CID 176847586
2-fluoro-N,N-bis(prop-2-enyl)acetamide (PubChem CID 176847586) has the molecular formula C8H12FNO and a molecular weight of 157.19 g/mol. Its IUPAC name is 2-fluoro-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-fluoro-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 176847586 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-fluoro-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CF |
| InChI | InChI=1S/C8H12FNO/c1-3-5-10(6-4-2)8(11)7-9/h3-4H,1-2,5-7H2 |
| InChIKey | CVBANOVBQMXPCS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|