C11H13Cl2NO2 — CID 86060579
5,5-dichloro-3-oxo-N,N-bis(prop-2-enyl)pent-4-enamide (PubChem CID 86060579) has the molecular formula C11H13Cl2NO2 and a molecular weight of 262.14 g/mol. Its IUPAC name is 5,5-dichloro-3-oxo-N,N-bis(prop-2-enyl)pent-4-enamide.
| Compound Name | 5,5-dichloro-3-oxo-N,N-bis(prop-2-enyl)pent-4-enamide |
|---|---|
| PubChem CID | 86060579 |
| Molecular Formula | C11H13Cl2NO2 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 5,5-dichloro-3-oxo-N,N-bis(prop-2-enyl)pent-4-enamide |
| SMILES | C=CCN(CC=C)C(=O)CC(=O)C=C(Cl)Cl |
| InChI | InChI=1S/C11H13Cl2NO2/c1-3-5-14(6-4-2)11(16)8-9(15)7-10(12)13/h3-4,7H,1-2,5-6,8H2 |
| InChIKey | MOXZQWARINDLKQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|