C8H10Cl3NO — CID 736559
2,2,2-trichloro-N,N-bis(prop-2-enyl)acetamide (PubChem CID 736559) has the molecular formula C8H10Cl3NO and a molecular weight of 242.53 g/mol. Its IUPAC name is 2,2,2-trichloro-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2,2,2-trichloro-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 736559 |
| Molecular Formula | C8H10Cl3NO |
| Molecular Weight | 242.53 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | 2,2,2-trichloro-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H10Cl3NO/c1-3-5-12(6-4-2)7(13)8(9,10)11/h3-4H,1-2,5-6H2 |
| InChIKey | FCLMEOAIBNBGBX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|