C13H11F10NO3 — CID 21156345
7-[bis(prop-2-enyl)amino]-2,2,3,3,4,4,5,5,6,6-decafluoro-7-oxoheptanoic acid (PubChem CID 21156345) has the molecular formula C13H11F10NO3 and a molecular weight of 419.22 g/mol. Its IUPAC name is 7-[bis(prop-2-enyl)amino]-2,2,3,3,4,4,5,5,6,6-decafluoro-7-oxoheptanoic acid.
| Compound Name | 7-[bis(prop-2-enyl)amino]-2,2,3,3,4,4,5,5,6,6-decafluoro-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 21156345 |
| Molecular Formula | C13H11F10NO3 |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 7-[bis(prop-2-enyl)amino]-2,2,3,3,4,4,5,5,6,6-decafluoro-7-oxoheptanoic acid |
| SMILES | C=CCN(CC=C)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C13H11F10NO3/c1-3-5-24(6-4-2)7(25)9(14,15)11(18,19)13(22,23)12(20,21)10(16,17)8(26)27/h3-4H,1-2,5-6H2,(H,26,27) |
| InChIKey | QOTBVKUMUNJBIJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|