C12H10ClF10NO — CID 3525541
6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N,N-bis(prop-2-enyl)hexanamide (PubChem CID 3525541) has the molecular formula C12H10ClF10NO and a molecular weight of 409.65 g/mol. Its IUPAC name is 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N,N-bis(prop-2-enyl)hexanamide.
| Compound Name | 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N,N-bis(prop-2-enyl)hexanamide |
|---|---|
| PubChem CID | 3525541 |
| Molecular Formula | C12H10ClF10NO |
| Molecular Weight | 409.65 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N,N-bis(prop-2-enyl)hexanamide |
| SMILES | C=CCN(CC=C)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C12H10ClF10NO/c1-3-5-24(6-4-2)7(25)8(14,15)9(16,17)10(18,19)11(20,21)12(13,22)23/h3-4H,1-2,5-6H2 |
| InChIKey | NRFUULCIFMFARG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|