C13H24N2O — CID 115431597
2-(aminomethyl)-2-ethyl-N,N-bis(prop-2-enyl)butanamide (PubChem CID 115431597) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-(aminomethyl)-2-ethyl-N,N-bis(prop-2-enyl)butanamide.
| Compound Name | 2-(aminomethyl)-2-ethyl-N,N-bis(prop-2-enyl)butanamide |
|---|---|
| PubChem CID | 115431597 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2-(aminomethyl)-2-ethyl-N,N-bis(prop-2-enyl)butanamide |
| SMILES | C=CCN(CC=C)C(=O)C(CC)(CC)CN |
| InChI | InChI=1S/C13H24N2O/c1-5-9-15(10-6-2)12(16)13(7-3,8-4)11-14/h5-6H,1-2,7-11,14H2,3-4H3 |
| InChIKey | VOFXUENMSFXOCY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|