C22H34ClF10NO — CID 3387387
6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N,N-dioctylhexanamide (PubChem CID 3387387) has the molecular formula C22H34ClF10NO and a molecular weight of 553.95 g/mol. Its IUPAC name is 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N,N-dioctylhexanamide.
| Compound Name | 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N,N-dioctylhexanamide |
|---|---|
| PubChem CID | 3387387 |
| Molecular Formula | C22H34ClF10NO |
| Molecular Weight | 553.95 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro-N,N-dioctylhexanamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C22H34ClF10NO/c1-3-5-7-9-11-13-15-34(16-14-12-10-8-6-4-2)17(35)18(24,25)19(26,27)20(28,29)21(30,31)22(23,32)33/h3-16H2,1-2H3 |
| InChIKey | HZUZTOXUQQEPIC-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.95 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|