C23H47NO — CID 532840
2,2-dimethyl-N,N-di(nonyl)propanamide (PubChem CID 532840) has the molecular formula C23H47NO and a molecular weight of 353.64 g/mol. Its IUPAC name is 2,2-dimethyl-N,N-di(nonyl)propanamide.
| Compound Name | 2,2-dimethyl-N,N-di(nonyl)propanamide |
|---|---|
| PubChem CID | 532840 |
| Molecular Formula | C23H47NO |
| Molecular Weight | 353.64 g/mol |
| Exact Mass | 353.37 |
| IUPAC Name | 2,2-dimethyl-N,N-di(nonyl)propanamide |
| SMILES | CCCCCCCCCN(CCCCCCCCC)C(=O)C(C)(C)C |
| InChI | InChI=1S/C23H47NO/c1-6-8-10-12-14-16-18-20-24(22(25)23(3,4)5)21-19-17-15-13-11-9-7-2/h6-21H2,1-5H3 |
| InChIKey | AFOUBMTWWBTOHI-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.64 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|