C7H11Cl3N2O3S — CID 134847390
2,2,2-trichloro-N-(dimethylsulfamoyl)-N-prop-2-enylacetamide (PubChem CID 134847390) has the molecular formula C7H11Cl3N2O3S and a molecular weight of 309.60 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(dimethylsulfamoyl)-N-prop-2-enylacetamide.
| Compound Name | 2,2,2-trichloro-N-(dimethylsulfamoyl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 134847390 |
| Molecular Formula | C7H11Cl3N2O3S |
| Molecular Weight | 309.60 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 2,2,2-trichloro-N-(dimethylsulfamoyl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)C(Cl)(Cl)Cl)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C7H11Cl3N2O3S/c1-4-5-12(6(13)7(8,9)10)16(14,15)11(2)3/h4H,1,5H2,2-3H3 |
| InChIKey | RVTARQWQDLOMLR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.60 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|