About chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid
chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid (PubChem CID 22495089) has the molecular formula C11H20ClNO2
and a molecular weight of 233.74 g/mol. Its IUPAC name is chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid.
Molecular Properties
| Compound Name | chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid |
| PubChem CID | 22495089 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid |
| SMILES | C=CC(=O)O.C=CCN(C)CC=C.CCl |
| InChI | InChI=1S/C7H13N.C3H4O2.CH3Cl/c1-4-6-8(3)7-5-2;1-2-3(4)5;1-2/h4-5H,1-2,6-7H2,3H3;2H,1H2,(H,4,5);1H3 |
| InChIKey | FJEPKXFHGYIABD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid?
The IUPAC name of chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid (CID 22495089) is chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid.
What is the SMILES notation for chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid?
The canonical SMILES for chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid is C=CC(=O)O.C=CCN(C)CC=C.CCl.
What is the InChIKey of chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid?
The InChIKey is FJEPKXFHGYIABD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C3H4O2.CH3Cl/c1-4-6-8(3)7-5-2;1-2-3(4)5;1-2/h4-5H,1-2,6-7H2,3H3;2H,1H2,(H,4,5);1H3.
What are the key properties of chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid?
chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid has a molecular weight of 233.74 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;N-methyl-N-prop-2-enylprop-2-en-1-amine;prop-2-enoic acid is sourced from PubChem (CID 22495089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).