C6H12N2O — CID 55207696
2-[methyl(prop-2-enyl)amino]acetamide (PubChem CID 55207696) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 2-[methyl(prop-2-enyl)amino]acetamide.
| Compound Name | 2-[methyl(prop-2-enyl)amino]acetamide |
|---|---|
| PubChem CID | 55207696 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 2-[methyl(prop-2-enyl)amino]acetamide |
| SMILES | C=CCN(C)CC(N)=O |
| InChI | InChI=1S/C6H12N2O/c1-3-4-8(2)5-6(7)9/h3H,1,4-5H2,2H3,(H2,7,9) |
| InChIKey | YEOOCPWXOADHKR-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|