C10H16N2O2 — CID 71483404
N,N'-dimethyl-N,N'-bis(prop-2-enyl)oxamide (PubChem CID 71483404) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis(prop-2-enyl)oxamide.
| Compound Name | N,N'-dimethyl-N,N'-bis(prop-2-enyl)oxamide |
|---|---|
| PubChem CID | 71483404 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis(prop-2-enyl)oxamide |
| SMILES | C=CCN(C)C(=O)C(=O)N(C)CC=C |
| InChI | InChI=1S/C10H16N2O2/c1-5-7-11(3)9(13)10(14)12(4)8-6-2/h5-6H,1-2,7-8H2,3-4H3 |
| InChIKey | ZRCLBHZKYNPTIY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|