C8H15NO3 — CID 143154091
(2R,3S)-2,3-dihydroxy-N-methyl-N-prop-2-enylbutanamide (PubChem CID 143154091) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (2R,3S)-2,3-dihydroxy-N-methyl-N-prop-2-enylbutanamide.
| Compound Name | (2R,3S)-2,3-dihydroxy-N-methyl-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 143154091 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (2R,3S)-2,3-dihydroxy-N-methyl-N-prop-2-enylbutanamide |
| SMILES | C=CCN(C)C(=O)[C@H](O)[C@H](C)O |
| InChI | InChI=1S/C8H15NO3/c1-4-5-9(3)8(12)7(11)6(2)10/h4,6-7,10-11H,1,5H2,2-3H3/t6-,7+/m0/s1 |
| InChIKey | RNKOTXXPZIHEMT-NKWVEPMBSA-N |
| XLogP | -0.63 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|