C6H11NO3 — CID 175330180
N,2-dihydroxy-N-prop-2-enylpropanamide (PubChem CID 175330180) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is N,2-dihydroxy-N-prop-2-enylpropanamide.
| Compound Name | N,2-dihydroxy-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 175330180 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | N,2-dihydroxy-N-prop-2-enylpropanamide |
| SMILES | C=CCN(O)C(=O)C(C)O |
| InChI | InChI=1S/C6H11NO3/c1-3-4-7(10)6(9)5(2)8/h3,5,8,10H,1,4H2,2H3 |
| InChIKey | JEPRSYWAFWZCMZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|