C12H21NO3 — CID 143479140
2,3-dihydroxy-N-(2-methylidenebut-3-enyl)-N-propylbutanamide (PubChem CID 143479140) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 2,3-dihydroxy-N-(2-methylidenebut-3-enyl)-N-propylbutanamide.
| Compound Name | 2,3-dihydroxy-N-(2-methylidenebut-3-enyl)-N-propylbutanamide |
|---|---|
| PubChem CID | 143479140 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2,3-dihydroxy-N-(2-methylidenebut-3-enyl)-N-propylbutanamide |
| SMILES | C=CC(=C)CN(CCC)C(=O)C(O)C(C)O |
| InChI | InChI=1S/C12H21NO3/c1-5-7-13(8-9(3)6-2)12(16)11(15)10(4)14/h6,10-11,14-15H,2-3,5,7-8H2,1,4H3 |
| InChIKey | VZSHBOOFBAUYHV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|