C11H24N2O — CID 22690786
(2S)-2-amino-3-methyl-N,N-dipropylbutanamide (PubChem CID 22690786) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N,N-dipropylbutanamide.
| Compound Name | (2S)-2-amino-3-methyl-N,N-dipropylbutanamide |
|---|---|
| PubChem CID | 22690786 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | (2S)-2-amino-3-methyl-N,N-dipropylbutanamide |
| SMILES | CCCN(CCC)C(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C11H24N2O/c1-5-7-13(8-6-2)11(14)10(12)9(3)4/h9-10H,5-8,12H2,1-4H3/t10-/m0/s1 |
| InChIKey | IHZRVAGMJMTQML-JTQLQIEISA-N |
| XLogP | 1.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |