C9H18N4O3 — CID 62921574
2-amino-N,N-bis(2-amino-2-oxoethyl)-3-methylbutanamide (PubChem CID 62921574) has the molecular formula C9H18N4O3 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-amino-N,N-bis(2-amino-2-oxoethyl)-3-methylbutanamide.
| Compound Name | 2-amino-N,N-bis(2-amino-2-oxoethyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 62921574 |
| Molecular Formula | C9H18N4O3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-amino-N,N-bis(2-amino-2-oxoethyl)-3-methylbutanamide |
| SMILES | CC(C)C(N)C(=O)N(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C9H18N4O3/c1-5(2)8(12)9(16)13(3-6(10)14)4-7(11)15/h5,8H,3-4,12H2,1-2H3,(H2,10,14)(H2,11,15) |
| InChIKey | NGTWFZDBQPQLCL-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |