C10H20N4O3 — CID 62922094
(2S)-2-amino-N,N-bis(2-amino-2-oxoethyl)-4-methylpentanamide (PubChem CID 62922094) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2S)-2-amino-N,N-bis(2-amino-2-oxoethyl)-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N,N-bis(2-amino-2-oxoethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 62922094 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (2S)-2-amino-N,N-bis(2-amino-2-oxoethyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C10H20N4O3/c1-6(2)3-7(11)10(17)14(4-8(12)15)5-9(13)16/h6-7H,3-5,11H2,1-2H3,(H2,12,15)(H2,13,16)/t7-/m0/s1 |
| InChIKey | QHFBHTMENGVOCT-ZETCQYMHSA-N |
| XLogP | -1.84 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |