C7H17N3O — CID 116848873
2-amino-N,4-dimethylpentanehydrazide (PubChem CID 116848873) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-amino-N,4-dimethylpentanehydrazide.
| Compound Name | 2-amino-N,4-dimethylpentanehydrazide |
|---|---|
| PubChem CID | 116848873 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 2-amino-N,4-dimethylpentanehydrazide |
| SMILES | CC(C)CC(N)C(=O)N(C)N |
| InChI | InChI=1S/C7H17N3O/c1-5(2)4-6(8)7(11)10(3)9/h5-6H,4,8-9H2,1-3H3 |
| InChIKey | VECVRXTWPHGGJN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|