C10H22N2O2 — CID 61159296
(2S)-2-amino-N-(2-methoxyethyl)-N,4-dimethylpentanamide (PubChem CID 61159296) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-methoxyethyl)-N,4-dimethylpentanamide.
| Compound Name | (2S)-2-amino-N-(2-methoxyethyl)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 61159296 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (2S)-2-amino-N-(2-methoxyethyl)-N,4-dimethylpentanamide |
| SMILES | COCCN(C)C(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C10H22N2O2/c1-8(2)7-9(11)10(13)12(3)5-6-14-4/h8-9H,5-7,11H2,1-4H3/t9-/m0/s1 |
| InChIKey | VQSJUOWFFLITTF-VIFPVBQESA-N |
| XLogP | 0.46 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |