C13H27N3O3 — CID 61163445
(2S)-2-amino-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N,4-dimethylpentanamide (PubChem CID 61163445) has the molecular formula C13H27N3O3 and a molecular weight of 273.38 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N,4-dimethylpentanamide.
| Compound Name | (2S)-2-amino-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 61163445 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (2S)-2-amino-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N,4-dimethylpentanamide |
| SMILES | COCCCNC(=O)CN(C)C(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C13H27N3O3/c1-10(2)8-11(14)13(18)16(3)9-12(17)15-6-5-7-19-4/h10-11H,5-9,14H2,1-4H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | YULDUWRBMDPXNV-NSHDSACASA-N |
| XLogP | -0.03 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|