C11H23N3O3 — CID 62472504
2-amino-4-methoxy-N-methyl-N-[2-oxo-2-(propylamino)ethyl]butanamide (PubChem CID 62472504) has the molecular formula C11H23N3O3 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-amino-4-methoxy-N-methyl-N-[2-oxo-2-(propylamino)ethyl]butanamide.
| Compound Name | 2-amino-4-methoxy-N-methyl-N-[2-oxo-2-(propylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 62472504 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | 2-amino-4-methoxy-N-methyl-N-[2-oxo-2-(propylamino)ethyl]butanamide |
| SMILES | CCCNC(=O)CN(C)C(=O)C(N)CCOC |
| InChI | InChI=1S/C11H23N3O3/c1-4-6-13-10(15)8-14(2)11(16)9(12)5-7-17-3/h9H,4-8,12H2,1-3H3,(H,13,15) |
| InChIKey | KNGRTHVUWUQSQH-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |