C9H18F2N2O — CID 104904051
(2R)-2-amino-N-(2,2-difluoroethyl)-N,4-dimethylpentanamide (PubChem CID 104904051) has the molecular formula C9H18F2N2O and a molecular weight of 208.25 g/mol. Its IUPAC name is (2R)-2-amino-N-(2,2-difluoroethyl)-N,4-dimethylpentanamide.
| Compound Name | (2R)-2-amino-N-(2,2-difluoroethyl)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 104904051 |
| Molecular Formula | C9H18F2N2O |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | (2R)-2-amino-N-(2,2-difluoroethyl)-N,4-dimethylpentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)N(C)CC(F)F |
| InChI | InChI=1S/C9H18F2N2O/c1-6(2)4-7(12)9(14)13(3)5-8(10)11/h6-8H,4-5,12H2,1-3H3/t7-/m1/s1 |
| InChIKey | YEHJJTWPNNHVFJ-SSDOTTSWSA-N |
| XLogP | 1.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |