About (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide
(2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide (PubChem CID 61164738) has the molecular formula C13H25N3O2
and a molecular weight of 255.36 g/mol. Its IUPAC name is (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide |
| PubChem CID | 61164738 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N(C)CC(=O)N1CCCC1 |
| InChI | InChI=1S/C13H25N3O2/c1-10(2)8-11(14)13(18)15(3)9-12(17)16-6-4-5-7-16/h10-11H,4-9,14H2,1-3H3/t11-/m0/s1 |
| InChIKey | MXAPPARQZORGGA-NSHDSACASA-N |
| XLogP | 0.44 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide?
The IUPAC name of (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide (CID 61164738) is (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide.
What is the SMILES notation for (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide?
The canonical SMILES for (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide is CC(C)C[C@H](N)C(=O)N(C)CC(=O)N1CCCC1.
What is the InChIKey of (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide?
The InChIKey is MXAPPARQZORGGA-NSHDSACASA-N. The full InChI is InChI=1S/C13H25N3O2/c1-10(2)8-11(14)13(18)15(3)9-12(17)16-6-4-5-7-16/h10-11H,4-9,14H2,1-3H3/t11-/m0/s1.
What are the key properties of (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide?
(2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide has a molecular weight of 255.36 g/mol, XLogP of 0.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N,4-dimethyl-N-(2-oxo-2-pyrrolidin-1-ylethyl)pentanamide is sourced from PubChem (CID 61164738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).