C9H18ClNO2 — CID 174374169
butane-2,3-dione;N,N-dimethylprop-2-en-1-amine;hydrochloride (PubChem CID 174374169) has the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. Its IUPAC name is butane-2,3-dione;N,N-dimethylprop-2-en-1-amine;hydrochloride.
| Compound Name | butane-2,3-dione;N,N-dimethylprop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 174374169 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | butane-2,3-dione;N,N-dimethylprop-2-en-1-amine;hydrochloride |
| SMILES | C=CCN(C)C.CC(=O)C(C)=O.Cl |
| InChI | InChI=1S/C5H11N.C4H6O2.ClH/c1-4-5-6(2)3;1-3(5)4(2)6;/h4H,1,5H2,2-3H3;1-2H3;1H |
| InChIKey | AVKTZWCNOYETJX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|