C5H13AuCl2N — CID 174904826
N,N-dimethylprop-2-en-1-amine;gold;dihydrochloride (PubChem CID 174904826) has the molecular formula C5H13AuCl2N and a molecular weight of 355.04 g/mol. Its IUPAC name is N,N-dimethylprop-2-en-1-amine;gold;dihydrochloride.
| Compound Name | N,N-dimethylprop-2-en-1-amine;gold;dihydrochloride |
|---|---|
| PubChem CID | 174904826 |
| Molecular Formula | C5H13AuCl2N |
| Molecular Weight | 355.04 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | N,N-dimethylprop-2-en-1-amine;gold;dihydrochloride |
| SMILES | C=CCN(C)C.Cl.Cl.[Au] |
| InChI | InChI=1S/C5H11N.Au.2ClH/c1-4-5-6(2)3;;;/h4H,1,5H2,2-3H3;;2*1H |
| InChIKey | MEXAQFUZPFPGSU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.04 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|