C5H17N3 — CID 87892299
azane;N,N-dimethylprop-2-en-1-amine (PubChem CID 87892299) has the molecular formula C5H17N3 and a molecular weight of 119.21 g/mol. Its IUPAC name is azane;N,N-dimethylprop-2-en-1-amine.
| Compound Name | azane;N,N-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 87892299 |
| Molecular Formula | C5H17N3 |
| Molecular Weight | 119.21 g/mol |
| Exact Mass | 119.14 |
| IUPAC Name | azane;N,N-dimethylprop-2-en-1-amine |
| SMILES | C=CCN(C)C.N.N |
| InChI | InChI=1S/C5H11N.2H3N/c1-4-5-6(2)3;;/h4H,1,5H2,2-3H3;2*1H3 |
| InChIKey | FJPXIVLWRPXEIR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|