C5H15ClNO4P — CID 174858360
N,N-dimethylprop-2-en-1-amine;phosphoric acid;hydrochloride (PubChem CID 174858360) has the molecular formula C5H15ClNO4P and a molecular weight of 219.60 g/mol. Its IUPAC name is N,N-dimethylprop-2-en-1-amine;phosphoric acid;hydrochloride.
| Compound Name | N,N-dimethylprop-2-en-1-amine;phosphoric acid;hydrochloride |
|---|---|
| PubChem CID | 174858360 |
| Molecular Formula | C5H15ClNO4P |
| Molecular Weight | 219.60 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | N,N-dimethylprop-2-en-1-amine;phosphoric acid;hydrochloride |
| SMILES | C=CCN(C)C.Cl.O=P(O)(O)O |
| InChI | InChI=1S/C5H11N.ClH.H3O4P/c1-4-5-6(2)3;;1-5(2,3)4/h4H,1,5H2,2-3H3;1H;(H3,1,2,3,4) |
| InChIKey | VVVGFWZGXPSRCA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.60 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|