C5H13NO6P2 — CID 4297291
[phosphonomethyl(prop-2-enyl)amino]methylphosphonic acid (PubChem CID 4297291) has the molecular formula C5H13NO6P2 and a molecular weight of 245.11 g/mol. Its IUPAC name is [phosphonomethyl(prop-2-enyl)amino]methylphosphonic acid.
| Compound Name | [phosphonomethyl(prop-2-enyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 4297291 |
| Molecular Formula | C5H13NO6P2 |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | [phosphonomethyl(prop-2-enyl)amino]methylphosphonic acid |
| SMILES | C=CCN(CP(=O)(O)O)CP(=O)(O)O |
| InChI | InChI=1S/C5H13NO6P2/c1-2-3-6(4-13(7,8)9)5-14(10,11)12/h2H,1,3-5H2,(H2,7,8,9)(H2,10,11,12) |
| InChIKey | BZIDMYLHMFSOPQ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|