C11H20NO2PS — CID 88660542
2-[bis(prop-2-enyl)amino]ethylsulfanyl-prop-2-enylphosphinic acid (PubChem CID 88660542) has the molecular formula C11H20NO2PS and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)amino]ethylsulfanyl-prop-2-enylphosphinic acid.
| Compound Name | 2-[bis(prop-2-enyl)amino]ethylsulfanyl-prop-2-enylphosphinic acid |
|---|---|
| PubChem CID | 88660542 |
| Molecular Formula | C11H20NO2PS |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[bis(prop-2-enyl)amino]ethylsulfanyl-prop-2-enylphosphinic acid |
| SMILES | C=CCN(CC=C)CCSP(=O)(O)CC=C |
| InChI | InChI=1S/C11H20NO2PS/c1-4-7-12(8-5-2)9-11-16-15(13,14)10-6-3/h4-6H,1-3,7-11H2,(H,13,14) |
| InChIKey | OGXIBYAADZALAM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|