C10H19N3O2 — CID 88985186
2-[bis(prop-2-enyl)amino]ethyl 2,2-diaminoacetate (PubChem CID 88985186) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)amino]ethyl 2,2-diaminoacetate.
| Compound Name | 2-[bis(prop-2-enyl)amino]ethyl 2,2-diaminoacetate |
|---|---|
| PubChem CID | 88985186 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-[bis(prop-2-enyl)amino]ethyl 2,2-diaminoacetate |
| SMILES | C=CCN(CC=C)CCOC(=O)C(N)N |
| InChI | InChI=1S/C10H19N3O2/c1-3-5-13(6-4-2)7-8-15-10(14)9(11)12/h3-4,9H,1-2,5-8,11-12H2 |
| InChIKey | LPTLPTPEVYQDQT-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|