C17H28N2O — CID 174738090
1,5-bis[bis(prop-2-enyl)amino]pentan-3-one (PubChem CID 174738090) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 1,5-bis[bis(prop-2-enyl)amino]pentan-3-one.
| Compound Name | 1,5-bis[bis(prop-2-enyl)amino]pentan-3-one |
|---|---|
| PubChem CID | 174738090 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1,5-bis[bis(prop-2-enyl)amino]pentan-3-one |
| SMILES | C=CCN(CC=C)CCC(=O)CCN(CC=C)CC=C |
| InChI | InChI=1S/C17H28N2O/c1-5-11-18(12-6-2)15-9-17(20)10-16-19(13-7-3)14-8-4/h5-8H,1-4,9-16H2 |
| InChIKey | WGKQJCPZFYWQAQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|