C13H23NO — CID 62623498
1-[bis(prop-2-enyl)amino]-4,4-dimethylpentan-3-one (PubChem CID 62623498) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-[bis(prop-2-enyl)amino]-4,4-dimethylpentan-3-one.
| Compound Name | 1-[bis(prop-2-enyl)amino]-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 62623498 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-[bis(prop-2-enyl)amino]-4,4-dimethylpentan-3-one |
| SMILES | C=CCN(CC=C)CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H23NO/c1-6-9-14(10-7-2)11-8-12(15)13(3,4)5/h6-7H,1-2,8-11H2,3-5H3 |
| InChIKey | PULPDQYQMVXRSP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|