C11H18ClNO — CID 39254844
3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoyl chloride (PubChem CID 39254844) has the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. Its IUPAC name is 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoyl chloride.
| Compound Name | 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoyl chloride |
|---|---|
| PubChem CID | 39254844 |
| Molecular Formula | C11H18ClNO |
| Molecular Weight | 215.72 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-[bis(prop-2-enyl)amino]-2,2-dimethylpropanoyl chloride |
| SMILES | C=CCN(CC=C)CC(C)(C)C(=O)Cl |
| InChI | InChI=1S/C11H18ClNO/c1-5-7-13(8-6-2)9-11(3,4)10(12)14/h5-6H,1-2,7-9H2,3-4H3 |
| InChIKey | KSEPRUCIFVJCBM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.72 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|