C22H38NO4- — CID 21364876
ditert-butyl 2-[[bis(prop-2-enyl)amino]methyl]-4-methanidyl-2-methylpentanedioate (PubChem CID 21364876) has the molecular formula C22H38NO4- and a molecular weight of 380.55 g/mol. Its IUPAC name is ditert-butyl 2-[[bis(prop-2-enyl)amino]methyl]-4-methanidyl-2-methylpentanedioate.
| Compound Name | ditert-butyl 2-[[bis(prop-2-enyl)amino]methyl]-4-methanidyl-2-methylpentanedioate |
|---|---|
| PubChem CID | 21364876 |
| Molecular Formula | C22H38NO4- |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | ditert-butyl 2-[[bis(prop-2-enyl)amino]methyl]-4-methanidyl-2-methylpentanedioate |
| SMILES | C=CCN(CC=C)CC(C)(CC([CH2-])C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H38NO4/c1-11-13-23(14-12-2)16-22(10,19(25)27-21(7,8)9)15-17(3)18(24)26-20(4,5)6/h11-12,17H,1-3,13-16H2,4-10H3/q-1 |
| InChIKey | GWWBRTBPOWTLGH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|