C15H30N2O2 — CID 142306508
tert-butyl N-but-3-enyl-N-prop-2-enylcarbamate;ethene;methanamine (PubChem CID 142306508) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is tert-butyl N-but-3-enyl-N-prop-2-enylcarbamate;ethene;methanamine.
| Compound Name | tert-butyl N-but-3-enyl-N-prop-2-enylcarbamate;ethene;methanamine |
|---|---|
| PubChem CID | 142306508 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | tert-butyl N-but-3-enyl-N-prop-2-enylcarbamate;ethene;methanamine |
| SMILES | C=C.C=CCCN(CC=C)C(=O)OC(C)(C)C.CN |
| InChI | InChI=1S/C12H21NO2.C2H4.CH5N/c1-6-8-10-13(9-7-2)11(14)15-12(3,4)5;2*1-2/h6-7H,1-2,8-10H2,3-5H3;1-2H2;2H2,1H3 |
| InChIKey | JAAFWHDADKBUTC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|