C13H23NO5 — CID 11380287
tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino] carbonate (PubChem CID 11380287) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino] carbonate.
| Compound Name | tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino] carbonate |
|---|---|
| PubChem CID | 11380287 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino] carbonate |
| SMILES | C=CCN(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO5/c1-8-9-14(10(15)17-12(2,3)4)19-11(16)18-13(5,6)7/h8H,1,9H2,2-7H3 |
| InChIKey | OWTLNQZSIHCEHY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|