C22H38N2O9 — CID 11145189
methyl (E,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyloxy]amino]hex-4-enoate (PubChem CID 11145189) has the molecular formula C22H38N2O9 and a molecular weight of 474.55 g/mol. Its IUPAC name is methyl (E,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyloxy]amino]hex-4-enoate.
| Compound Name | methyl (E,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyloxy]amino]hex-4-enoate |
|---|---|
| PubChem CID | 11145189 |
| Molecular Formula | C22H38N2O9 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | methyl (E,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2-methylpropan-2-yl)oxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyloxy]amino]hex-4-enoate |
| SMILES | COC(=O)[C@H](C/C=C/CN(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H38N2O9/c1-20(2,3)30-17(26)23-15(16(25)29-10)13-11-12-14-24(18(27)31-21(4,5)6)33-19(28)32-22(7,8)9/h11-12,15H,13-14H2,1-10H3,(H,23,26)/b12-11+/t15-/m0/s1 |
| InChIKey | NTRIAIKAHNMCNO-RUMSDORHSA-N |
| XLogP | 4.10 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|