C11H21N3O6 — CID 100992827
methyl 2-[[2-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-3-hydroxypropanoate (PubChem CID 100992827) has the molecular formula C11H21N3O6 and a molecular weight of 291.30 g/mol. Its IUPAC name is methyl 2-[[2-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[[2-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 100992827 |
| Molecular Formula | C11H21N3O6 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | methyl 2-[[2-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)C(N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21N3O6/c1-11(2,3)20-10(18)14-7(12)8(16)13-6(5-15)9(17)19-4/h6-7,15H,5,12H2,1-4H3,(H,13,16)(H,14,18) |
| InChIKey | YNYKZPXKIKDRGM-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|