C21H31NO6 — CID 10834407
tert-butyl [[(E)-3-(4-methoxyphenyl)but-2-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate (PubChem CID 10834407) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is tert-butyl [[(E)-3-(4-methoxyphenyl)but-2-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate.
| Compound Name | tert-butyl [[(E)-3-(4-methoxyphenyl)but-2-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
|---|---|
| PubChem CID | 10834407 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | tert-butyl [[(E)-3-(4-methoxyphenyl)but-2-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
| SMILES | COc1ccc(/C(C)=C/CN(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H31NO6/c1-15(16-9-11-17(25-8)12-10-16)13-14-22(18(23)26-20(2,3)4)28-19(24)27-21(5,6)7/h9-13H,14H2,1-8H3/b15-13+ |
| InChIKey | PZVQSEURCLDELR-FYWRMAATSA-N |
| XLogP | 5.20 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|