C20H29NO7S — CID 18368972
tert-butyl [3-(4-methoxyphenyl)sulfanylpropanoyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate (PubChem CID 18368972) has the molecular formula C20H29NO7S and a molecular weight of 427.52 g/mol. Its IUPAC name is tert-butyl [3-(4-methoxyphenyl)sulfanylpropanoyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate.
| Compound Name | tert-butyl [3-(4-methoxyphenyl)sulfanylpropanoyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
|---|---|
| PubChem CID | 18368972 |
| Molecular Formula | C20H29NO7S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | tert-butyl [3-(4-methoxyphenyl)sulfanylpropanoyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
| SMILES | COc1ccc(SCCC(=O)N(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H29NO7S/c1-19(2,3)26-17(23)21(28-18(24)27-20(4,5)6)16(22)12-13-29-15-10-8-14(25-7)9-11-15/h8-11H,12-13H2,1-7H3 |
| InChIKey | BNTYZVSNQLOFMY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|