C30H41NO7 — CID 10697459
tert-butyl [[(E)-3-[3-(4-methoxyphenoxy)phenyl]hept-2-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate (PubChem CID 10697459) has the molecular formula C30H41NO7 and a molecular weight of 527.66 g/mol. Its IUPAC name is tert-butyl [[(E)-3-[3-(4-methoxyphenoxy)phenyl]hept-2-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate.
| Compound Name | tert-butyl [[(E)-3-[3-(4-methoxyphenoxy)phenyl]hept-2-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
|---|---|
| PubChem CID | 10697459 |
| Molecular Formula | C30H41NO7 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | tert-butyl [[(E)-3-[3-(4-methoxyphenoxy)phenyl]hept-2-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
| SMILES | CCCC/C(=C\CN(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c1cccc(Oc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C30H41NO7/c1-9-10-12-22(23-13-11-14-26(21-23)35-25-17-15-24(34-8)16-18-25)19-20-31(27(32)36-29(2,3)4)38-28(33)37-30(5,6)7/h11,13-19,21H,9-10,12,20H2,1-8H3/b22-19+ |
| InChIKey | XSZZZBXNMVVTTJ-ZBJSNUHESA-N |
| XLogP | 8.16 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|