C39H51F3N2O7 — CID 10771121
tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-[(E)-3-[3-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]undec-2-enyl]amino] carbonate (PubChem CID 10771121) has the molecular formula C39H51F3N2O7 and a molecular weight of 716.84 g/mol. Its IUPAC name is tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-[(E)-3-[3-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]undec-2-enyl]amino] carbonate.
| Compound Name | tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-[(E)-3-[3-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]undec-2-enyl]amino] carbonate |
|---|---|
| PubChem CID | 10771121 |
| Molecular Formula | C39H51F3N2O7 |
| Molecular Weight | 716.84 g/mol |
| Exact Mass | 716.36 |
| IUPAC Name | tert-butyl [(2-methylpropan-2-yl)oxycarbonyl-[(E)-3-[3-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]undec-2-enyl]amino] carbonate |
| SMILES | CCCCCCCC/C(=C\CN(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c1cccc(OCc2nc(-c3ccc(C(F)(F)F)cc3)oc2C)c1 |
| InChI | InChI=1S/C39H51F3N2O7/c1-9-10-11-12-13-14-16-28(23-24-44(35(45)49-37(3,4)5)51-36(46)50-38(6,7)8)30-17-15-18-32(25-30)47-26-33-27(2)48-34(43-33)29-19-21-31(22-20-29)39(40,41)42/h15,17-23,25H,9-14,16,24,26H2,1-8H3/b28-23+ |
| InChIKey | GAKJOOSLSBLCJJ-WEMUOSSPSA-N |
| XLogP | 11.49 |
| TPSA | 100.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.84 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|