C24H22F3NO5 — CID 10837705
ethyl (E)-3-[3-[[5-methyl-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]but-2-enoate (PubChem CID 10837705) has the molecular formula C24H22F3NO5 and a molecular weight of 461.44 g/mol. Its IUPAC name is ethyl (E)-3-[3-[[5-methyl-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]but-2-enoate.
| Compound Name | ethyl (E)-3-[3-[[5-methyl-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]but-2-enoate |
|---|---|
| PubChem CID | 10837705 |
| Molecular Formula | C24H22F3NO5 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | ethyl (E)-3-[3-[[5-methyl-2-[4-(trifluoromethoxy)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)c1cccc(OCc2nc(-c3ccc(OC(F)(F)F)cc3)oc2C)c1 |
| InChI | InChI=1S/C24H22F3NO5/c1-4-30-22(29)12-15(2)18-6-5-7-20(13-18)31-14-21-16(3)32-23(28-21)17-8-10-19(11-9-17)33-24(25,26)27/h5-13H,4,14H2,1-3H3/b15-12+ |
| InChIKey | OTIIORBUHNWDPO-NTCAYCPXSA-N |
| XLogP | 6.09 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|