C31H36F3NO4 — CID 10650178
ethyl (Z)-3-[3-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]undec-2-enoate (PubChem CID 10650178) has the molecular formula C31H36F3NO4 and a molecular weight of 543.63 g/mol. Its IUPAC name is ethyl (Z)-3-[3-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]undec-2-enoate.
| Compound Name | ethyl (Z)-3-[3-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]undec-2-enoate |
|---|---|
| PubChem CID | 10650178 |
| Molecular Formula | C31H36F3NO4 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | ethyl (Z)-3-[3-[[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]undec-2-enoate |
| SMILES | CCCCCCCC/C(=C/C(=O)OCC)c1cccc(OCc2nc(-c3ccc(C(F)(F)F)cc3)oc2C)c1 |
| InChI | InChI=1S/C31H36F3NO4/c1-4-6-7-8-9-10-12-25(20-29(36)37-5-2)24-13-11-14-27(19-24)38-21-28-22(3)39-30(35-28)23-15-17-26(18-16-23)31(32,33)34/h11,13-20H,4-10,12,21H2,1-3H3/b25-20- |
| InChIKey | IKXUORPGXHBVOA-QQTULTPQSA-N |
| XLogP | 8.94 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|