C12H23NO2 — CID 10375927
tert-butyl N-butan-2-yl-N-prop-2-enylcarbamate (PubChem CID 10375927) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is tert-butyl N-butan-2-yl-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-butan-2-yl-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 10375927 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | tert-butyl N-butan-2-yl-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)C(C)CC |
| InChI | InChI=1S/C12H23NO2/c1-7-9-13(10(3)8-2)11(14)15-12(4,5)6/h7,10H,1,8-9H2,2-6H3 |
| InChIKey | WXBVFWJPBJULNQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|